C26H30N4O6 — CID 68636332
5-[[4-(2-methyl-3-phenylprop-2-enyl)piperazin-1-yl]methyl]-4,8-dioxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraene;oxalic acid (PubChem CID 68636332) has the molecular formula C26H30N4O6 and a molecular weight of 494.55 g/mol. Its IUPAC name is 5-[[4-(2-methyl-3-phenylprop-2-enyl)piperazin-1-yl]methyl]-4,8-dioxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraene;oxalic acid.
| Compound Name | 5-[[4-(2-methyl-3-phenylprop-2-enyl)piperazin-1-yl]methyl]-4,8-dioxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraene;oxalic acid |
|---|---|
| PubChem CID | 68636332 |
| Molecular Formula | C26H30N4O6 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 5-[[4-(2-methyl-3-phenylprop-2-enyl)piperazin-1-yl]methyl]-4,8-dioxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraene;oxalic acid |
| SMILES | CC(=Cc1ccccc1)CN1CCN(CC2ON=C3c4ccncc4OCC32)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H28N4O2.C2H2O4/c1-18(13-19-5-3-2-4-6-19)15-27-9-11-28(12-10-27)16-23-21-17-29-22-14-25-8-7-20(22)24(21)26-30-23;3-1(4)2(5)6/h2-8,13-14,21,23H,9-12,15-17H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | AIPYSWDNDNHICS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|