C18H32N2O3 — CID 68636839
1,3-di(heptan-4-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 68636839) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is 1,3-di(heptan-4-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-di(heptan-4-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 68636839 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | 1,3-di(heptan-4-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCCC(CCC)N1C(=O)CC(=O)N(C(CCC)CCC)C1=O |
| InChI | InChI=1S/C18H32N2O3/c1-5-9-14(10-6-2)19-16(21)13-17(22)20(18(19)23)15(11-7-3)12-8-4/h14-15H,5-13H2,1-4H3 |
| InChIKey | QBXAHYUNFNGUNF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|