C34H46FN7O4Si — CID 68637205
2-[4-[[7-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl-(oxolan-3-yl)amino]propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 68637205) has the molecular formula C34H46FN7O4Si and a molecular weight of 663.87 g/mol. Its IUPAC name is 2-[4-[[7-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl-(oxolan-3-yl)amino]propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[4-[[7-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl-(oxolan-3-yl)amino]propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 68637205 |
| Molecular Formula | C34H46FN7O4Si |
| Molecular Weight | 663.87 g/mol |
| Exact Mass | 663.34 |
| IUPAC Name | 2-[4-[[7-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl-(oxolan-3-yl)amino]propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCN(CCCOc1ccc2c(Nc3cnn(CC(=O)Nc4cccc(F)c4)c3)ncnc2c1)C1CCOC1 |
| InChI | InChI=1S/C34H46FN7O4Si/c1-34(2,3)47(4,5)46-17-14-41(28-12-16-44-23-28)13-7-15-45-29-10-11-30-31(19-29)36-24-37-33(30)40-27-20-38-42(21-27)22-32(43)39-26-9-6-8-25(35)18-26/h6,8-11,18-21,24,28H,7,12-17,22-23H2,1-5H3,(H,39,43)(H,36,37,40) |
| InChIKey | ASCZTLHJTBCWEX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.87 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|