About 2-(cyclohexen-1-yl)-1,4-thiazepine
2-(cyclohexen-1-yl)-1,4-thiazepine (PubChem CID 68637312) has the molecular formula C11H13NS
and a molecular weight of 191.30 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-1,4-thiazepine.
Molecular Properties
| Compound Name | 2-(cyclohexen-1-yl)-1,4-thiazepine |
| PubChem CID | 68637312 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 2-(cyclohexen-1-yl)-1,4-thiazepine |
| SMILES | C1=CSC(C2=CCCCC2)=CN=C1 |
| InChI | InChI=1S/C11H13NS/c1-2-5-10(6-3-1)11-9-12-7-4-8-13-11/h4-5,7-9H,1-3,6H2 |
| InChIKey | CYDYGQBYUVSVKY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cyclohexen-1-yl)-1,4-thiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexen-1-yl)-1,4-thiazepine?
The IUPAC name of 2-(cyclohexen-1-yl)-1,4-thiazepine (CID 68637312) is 2-(cyclohexen-1-yl)-1,4-thiazepine.
What is the SMILES notation for 2-(cyclohexen-1-yl)-1,4-thiazepine?
The canonical SMILES for 2-(cyclohexen-1-yl)-1,4-thiazepine is C1=CSC(C2=CCCCC2)=CN=C1.
What is the InChIKey of 2-(cyclohexen-1-yl)-1,4-thiazepine?
The InChIKey is CYDYGQBYUVSVKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NS/c1-2-5-10(6-3-1)11-9-12-7-4-8-13-11/h4-5,7-9H,1-3,6H2.
What are the key properties of 2-(cyclohexen-1-yl)-1,4-thiazepine?
2-(cyclohexen-1-yl)-1,4-thiazepine has a molecular weight of 191.30 g/mol, XLogP of 3.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexen-1-yl)-1,4-thiazepine is sourced from PubChem (CID 68637312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).