C15H13F2NO2 — CID 686375
(1S)-1-(2,6-difluorophenyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol (PubChem CID 686375) has the molecular formula C15H13F2NO2 and a molecular weight of 277.27 g/mol. Its IUPAC name is (1S)-1-(2,6-difluorophenyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol.
| Compound Name | (1S)-1-(2,6-difluorophenyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
|---|---|
| PubChem CID | 686375 |
| Molecular Formula | C15H13F2NO2 |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | (1S)-1-(2,6-difluorophenyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| SMILES | Oc1cc2c(cc1O)[C@@H](c1c(F)cccc1F)NCC2 |
| InChI | InChI=1S/C15H13F2NO2/c16-10-2-1-3-11(17)14(10)15-9-7-13(20)12(19)6-8(9)4-5-18-15/h1-3,6-7,15,18-20H,4-5H2/t15-/m0/s1 |
| InChIKey | UVGQRNPTSHVVGZ-HNNXBMFYSA-N |
| XLogP | 2.61 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|