About tert-butyl 4-[furo[2,3-b]quinoline-4-carbonyl-(4-methoxyphenyl)sulfamoyl]butanoate
tert-butyl 4-[furo[2,3-b]quinoline-4-carbonyl-(4-methoxyphenyl)sulfamoyl]butanoate (PubChem CID 68637828) has the molecular formula C27H28N2O7S
and a molecular weight of 524.60 g/mol. Its IUPAC name is tert-butyl 4-[furo[2,3-b]quinoline-4-carbonyl-(4-methoxyphenyl)sulfamoyl]butanoate.
Molecular Properties
| Compound Name | tert-butyl 4-[furo[2,3-b]quinoline-4-carbonyl-(4-methoxyphenyl)sulfamoyl]butanoate |
| PubChem CID | 68637828 |
| Molecular Formula | C27H28N2O7S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | tert-butyl 4-[furo[2,3-b]quinoline-4-carbonyl-(4-methoxyphenyl)sulfamoyl]butanoate |
| SMILES | COc1ccc(N(C(=O)c2c3ccccc3nc3occc23)S(=O)(=O)CCCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H28N2O7S/c1-27(2,3)36-23(30)10-7-17-37(32,33)29(18-11-13-19(34-4)14-12-18)26(31)24-20-8-5-6-9-22(20)28-25-21(24)15-16-35-25/h5-6,8-9,11-16H,7,10,17H2,1-4H3 |
| InChIKey | YFVWRQWHAJYGEO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze tert-butyl 4-[furo[2,3-b]quinoline-4-carbonyl-(4-methoxyphenyl)sulfamoyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[furo[2,3-b]quinoline-4-carbonyl-(4-methoxyphenyl)sulfamoyl]butanoate?
The IUPAC name of tert-butyl 4-[furo[2,3-b]quinoline-4-carbonyl-(4-methoxyphenyl)sulfamoyl]butanoate (CID 68637828) is tert-butyl 4-[furo[2,3-b]quinoline-4-carbonyl-(4-methoxyphenyl)sulfamoyl]butanoate.
What is the SMILES notation for tert-butyl 4-[furo[2,3-b]quinoline-4-carbonyl-(4-methoxyphenyl)sulfamoyl]butanoate?
The canonical SMILES for tert-butyl 4-[furo[2,3-b]quinoline-4-carbonyl-(4-methoxyphenyl)sulfamoyl]butanoate is COc1ccc(N(C(=O)c2c3ccccc3nc3occc23)S(=O)(=O)CCCC(=O)OC(C)(C)C)cc1.
What is the InChIKey of tert-butyl 4-[furo[2,3-b]quinoline-4-carbonyl-(4-methoxyphenyl)sulfamoyl]butanoate?
The InChIKey is YFVWRQWHAJYGEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28N2O7S/c1-27(2,3)36-23(30)10-7-17-37(32,33)29(18-11-13-19(34-4)14-12-18)26(31)24-20-8-5-6-9-22(20)28-25-21(24)15-16-35-25/h5-6,8-9,11-16H,7,10,17H2,1-4H3.
What are the key properties of tert-butyl 4-[furo[2,3-b]quinoline-4-carbonyl-(4-methoxyphenyl)sulfamoyl]butanoate?
tert-butyl 4-[furo[2,3-b]quinoline-4-carbonyl-(4-methoxyphenyl)sulfamoyl]butanoate has a molecular weight of 524.60 g/mol, XLogP of 5.09, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[furo[2,3-b]quinoline-4-carbonyl-(4-methoxyphenyl)sulfamoyl]butanoate is sourced from PubChem (CID 68637828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).