C17H12O9 — CID 68637980
6-(3-carboxybenzoyl)cyclohexa-2,4-diene-1,1,2-tricarboxylic acid (PubChem CID 68637980) has the molecular formula C17H12O9 and a molecular weight of 360.27 g/mol. Its IUPAC name is 6-(3-carboxybenzoyl)cyclohexa-2,4-diene-1,1,2-tricarboxylic acid.
| Compound Name | 6-(3-carboxybenzoyl)cyclohexa-2,4-diene-1,1,2-tricarboxylic acid |
|---|---|
| PubChem CID | 68637980 |
| Molecular Formula | C17H12O9 |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 6-(3-carboxybenzoyl)cyclohexa-2,4-diene-1,1,2-tricarboxylic acid |
| SMILES | O=C(O)C1=CC=CC(C(=O)c2cccc(C(=O)O)c2)C1(C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H12O9/c18-12(8-3-1-4-9(7-8)13(19)20)10-5-2-6-11(14(21)22)17(10,15(23)24)16(25)26/h1-7,10H,(H,19,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | DCNBUIRZVPYXTP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|