C16H17FN4O2 — CID 68638151
N-(2-aminoethyl)-2-(7-fluoro-1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)acetamide (PubChem CID 68638151) has the molecular formula C16H17FN4O2 and a molecular weight of 316.34 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(7-fluoro-1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)acetamide.
| Compound Name | N-(2-aminoethyl)-2-(7-fluoro-1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)acetamide |
|---|---|
| PubChem CID | 68638151 |
| Molecular Formula | C16H17FN4O2 |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-(2-aminoethyl)-2-(7-fluoro-1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)acetamide |
| SMILES | NCCNC(=O)C=C1CCNC(=O)c2[nH]c3ccc(F)cc3c21 |
| InChI | InChI=1S/C16H17FN4O2/c17-10-1-2-12-11(8-10)14-9(7-13(22)19-6-4-18)3-5-20-16(23)15(14)21-12/h1-2,7-8,21H,3-6,18H2,(H,19,22)(H,20,23) |
| InChIKey | JHAQWAMQPPHSMZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|