C20H18N4O4S — CID 68638586
(2Z)-2-(1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)-N-(2-sulfamoylphenyl)acetamide (PubChem CID 68638586) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is (2Z)-2-(1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)-N-(2-sulfamoylphenyl)acetamide.
| Compound Name | (2Z)-2-(1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)-N-(2-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 68638586 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (2Z)-2-(1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)-N-(2-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccccc1NC(=O)/C=C1/CCNC(=O)c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C20H18N4O4S/c21-29(27,28)16-8-4-3-7-15(16)23-17(25)11-12-9-10-22-20(26)19-18(12)13-5-1-2-6-14(13)24-19/h1-8,11,24H,9-10H2,(H,22,26)(H,23,25)(H2,21,27,28)/b12-11- |
| InChIKey | RSAWSCGTFXVAKV-QXMHVHEDSA-N |
| XLogP | 1.97 |
| TPSA | 134.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|