C28H39NO5Si — CID 68638791
1-O-tert-butyl 2-O-methyl (2S,3S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-3-methylpyrrolidine-1,2-dicarboxylate (PubChem CID 68638791) has the molecular formula C28H39NO5Si and a molecular weight of 497.71 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,3S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-3-methylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,3S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-3-methylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 68638791 |
| Molecular Formula | C28H39NO5Si |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,3S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-3-methylpyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](C)[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H39NO5Si/c1-20-23(19-29(24(20)25(30)32-8)26(31)33-27(2,3)4)34-35(28(5,6)7,21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9-18,20,23-24H,19H2,1-8H3/t20-,23-,24+/m1/s1 |
| InChIKey | HDFFANMQDAMLBG-HUVFLSCGSA-N |
| XLogP | 4.36 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|