C19H30FNO — CID 68639262
1-(4-fluoropiperidin-1-yl)-2-methyl-4-(2,4,5-trimethylcyclohexa-1,4-dien-1-yl)butan-1-one (PubChem CID 68639262) has the molecular formula C19H30FNO and a molecular weight of 307.45 g/mol. Its IUPAC name is 1-(4-fluoropiperidin-1-yl)-2-methyl-4-(2,4,5-trimethylcyclohexa-1,4-dien-1-yl)butan-1-one.
| Compound Name | 1-(4-fluoropiperidin-1-yl)-2-methyl-4-(2,4,5-trimethylcyclohexa-1,4-dien-1-yl)butan-1-one |
|---|---|
| PubChem CID | 68639262 |
| Molecular Formula | C19H30FNO |
| Molecular Weight | 307.45 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 1-(4-fluoropiperidin-1-yl)-2-methyl-4-(2,4,5-trimethylcyclohexa-1,4-dien-1-yl)butan-1-one |
| SMILES | CC1=C(C)CC(CCC(C)C(=O)N2CCC(F)CC2)=C(C)C1 |
| InChI | InChI=1S/C19H30FNO/c1-13(19(22)21-9-7-18(20)8-10-21)5-6-17-12-15(3)14(2)11-16(17)4/h13,18H,5-12H2,1-4H3 |
| InChIKey | OTLRFQAUDAZKDL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|