C19H16ClIN4O2 — CID 68639379
2-chloro-4-[[(1S)-2-hydroxy-1-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]propyl]amino]-3-methylbenzonitrile (PubChem CID 68639379) has the molecular formula C19H16ClIN4O2 and a molecular weight of 494.72 g/mol. Its IUPAC name is 2-chloro-4-[[(1S)-2-hydroxy-1-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]propyl]amino]-3-methylbenzonitrile.
| Compound Name | 2-chloro-4-[[(1S)-2-hydroxy-1-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]propyl]amino]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 68639379 |
| Molecular Formula | C19H16ClIN4O2 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | 2-chloro-4-[[(1S)-2-hydroxy-1-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]propyl]amino]-3-methylbenzonitrile |
| SMILES | Cc1c(N[C@H](c2nnc(-c3ccc(I)cc3)o2)C(C)O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C19H16ClIN4O2/c1-10-15(8-5-13(9-22)16(10)20)23-17(11(2)26)19-25-24-18(27-19)12-3-6-14(21)7-4-12/h3-8,11,17,23,26H,1-2H3/t11?,17-/m0/s1 |
| InChIKey | RPSLJTGBAHSCTD-KLLZUTDZSA-N |
| XLogP | 4.71 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|