C19H14F3N7O3S — CID 68640224
1-[4-(4-methyl-1,3-thiazol-2-yl)-5-[5-(2-oxo-3H-1,3,4-oxadiazol-5-yl)-3-pyridinyl]-2-pyridinyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 68640224) has the molecular formula C19H14F3N7O3S and a molecular weight of 477.43 g/mol. Its IUPAC name is 1-[4-(4-methyl-1,3-thiazol-2-yl)-5-[5-(2-oxo-3H-1,3,4-oxadiazol-5-yl)-3-pyridinyl]-2-pyridinyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[4-(4-methyl-1,3-thiazol-2-yl)-5-[5-(2-oxo-3H-1,3,4-oxadiazol-5-yl)-3-pyridinyl]-2-pyridinyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 68640224 |
| Molecular Formula | C19H14F3N7O3S |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 1-[4-(4-methyl-1,3-thiazol-2-yl)-5-[5-(2-oxo-3H-1,3,4-oxadiazol-5-yl)-3-pyridinyl]-2-pyridinyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | Cc1csc(-c2cc(NC(=O)NCC(F)(F)F)ncc2-c2cncc(-c3n[nH]c(=O)o3)c2)n1 |
| InChI | InChI=1S/C19H14F3N7O3S/c1-9-7-33-16(26-9)12-3-14(27-17(30)25-8-19(20,21)22)24-6-13(12)10-2-11(5-23-4-10)15-28-29-18(31)32-15/h2-7H,8H2,1H3,(H,29,31)(H2,24,25,27,30) |
| InChIKey | HTVZELUMWPQCGK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |