C18H16FN3 — CID 68640329
3-(6-fluoro-2,3-dihydro-1H-inden-1-yl)quinoline-2,6-diamine (PubChem CID 68640329) has the molecular formula C18H16FN3 and a molecular weight of 293.35 g/mol. Its IUPAC name is 3-(6-fluoro-2,3-dihydro-1H-inden-1-yl)quinoline-2,6-diamine.
| Compound Name | 3-(6-fluoro-2,3-dihydro-1H-inden-1-yl)quinoline-2,6-diamine |
|---|---|
| PubChem CID | 68640329 |
| Molecular Formula | C18H16FN3 |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 3-(6-fluoro-2,3-dihydro-1H-inden-1-yl)quinoline-2,6-diamine |
| SMILES | Nc1ccc2nc(N)c(C3CCc4ccc(F)cc43)cc2c1 |
| InChI | InChI=1S/C18H16FN3/c19-12-3-1-10-2-5-14(15(10)9-12)16-8-11-7-13(20)4-6-17(11)22-18(16)21/h1,3-4,6-9,14H,2,5,20H2,(H2,21,22) |
| InChIKey | ZVHLIWMCMALHBH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|