About [3-[2-(5-chlorothiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-2,6-difluorophenyl]methanol
[3-[2-(5-chlorothiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-2,6-difluorophenyl]methanol (PubChem CID 68640382) has the molecular formula C18H11ClF2N2OS
and a molecular weight of 376.82 g/mol. Its IUPAC name is [3-[2-(5-chlorothiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-2,6-difluorophenyl]methanol.
Molecular Properties
| Compound Name | [3-[2-(5-chlorothiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-2,6-difluorophenyl]methanol |
| PubChem CID | 68640382 |
| Molecular Formula | C18H11ClF2N2OS |
| Molecular Weight | 376.82 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | [3-[2-(5-chlorothiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-2,6-difluorophenyl]methanol |
| SMILES | OCc1c(F)ccc(-c2ccc3nc(-c4ccc(Cl)s4)cn3c2)c1F |
| InChI | InChI=1S/C18H11ClF2N2OS/c19-16-5-4-15(25-16)14-8-23-7-10(1-6-17(23)22-14)11-2-3-13(20)12(9-24)18(11)21/h1-8,24H,9H2 |
| InChIKey | LNZRPIREVZKYIK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.82 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[2-(5-chlorothiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-2,6-difluorophenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-(5-chlorothiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-2,6-difluorophenyl]methanol?
The IUPAC name of [3-[2-(5-chlorothiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-2,6-difluorophenyl]methanol (CID 68640382) is [3-[2-(5-chlorothiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-2,6-difluorophenyl]methanol.
What is the SMILES notation for [3-[2-(5-chlorothiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-2,6-difluorophenyl]methanol?
The canonical SMILES for [3-[2-(5-chlorothiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-2,6-difluorophenyl]methanol is OCc1c(F)ccc(-c2ccc3nc(-c4ccc(Cl)s4)cn3c2)c1F.
What is the InChIKey of [3-[2-(5-chlorothiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-2,6-difluorophenyl]methanol?
The InChIKey is LNZRPIREVZKYIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11ClF2N2OS/c19-16-5-4-15(25-16)14-8-23-7-10(1-6-17(23)22-14)11-2-3-13(20)12(9-24)18(11)21/h1-8,24H,9H2.
What are the key properties of [3-[2-(5-chlorothiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-2,6-difluorophenyl]methanol?
[3-[2-(5-chlorothiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-2,6-difluorophenyl]methanol has a molecular weight of 376.82 g/mol, XLogP of 5.15, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-(5-chlorothiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-2,6-difluorophenyl]methanol is sourced from PubChem (CID 68640382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).