C18H30N2O4 — CID 68640517
4-[(4aS,8aS)-3-oxo-4a,5,6,7,8,8a-hexahydrobenzo[b][1,4]oxazin-4-yl]-2-tert-butylpiperidine-1-carboxylic acid (PubChem CID 68640517) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is 4-[(4aS,8aS)-3-oxo-4a,5,6,7,8,8a-hexahydrobenzo[b][1,4]oxazin-4-yl]-2-tert-butylpiperidine-1-carboxylic acid.
| Compound Name | 4-[(4aS,8aS)-3-oxo-4a,5,6,7,8,8a-hexahydrobenzo[b][1,4]oxazin-4-yl]-2-tert-butylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68640517 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 4-[(4aS,8aS)-3-oxo-4a,5,6,7,8,8a-hexahydrobenzo[b][1,4]oxazin-4-yl]-2-tert-butylpiperidine-1-carboxylic acid |
| SMILES | CC(C)(C)C1CC(N2C(=O)CO[C@H]3CCCC[C@@H]32)CCN1C(=O)O |
| InChI | InChI=1S/C18H30N2O4/c1-18(2,3)15-10-12(8-9-19(15)17(22)23)20-13-6-4-5-7-14(13)24-11-16(20)21/h12-15H,4-11H2,1-3H3,(H,22,23)/t12?,13-,14-,15?/m0/s1 |
| InChIKey | IYVGFKQGDYCPTE-GQKFXUNGSA-N |
| XLogP | 2.71 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |