C11H17NO6 — CID 68641024
8,8-dihydroxy-6-(hydroxymethyl)-2,2-dimethyl-6,7,8a,8b-tetrahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-4-one (PubChem CID 68641024) has the molecular formula C11H17NO6 and a molecular weight of 259.26 g/mol. Its IUPAC name is 8,8-dihydroxy-6-(hydroxymethyl)-2,2-dimethyl-6,7,8a,8b-tetrahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-4-one.
| Compound Name | 8,8-dihydroxy-6-(hydroxymethyl)-2,2-dimethyl-6,7,8a,8b-tetrahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-4-one |
|---|---|
| PubChem CID | 68641024 |
| Molecular Formula | C11H17NO6 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 8,8-dihydroxy-6-(hydroxymethyl)-2,2-dimethyl-6,7,8a,8b-tetrahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-4-one |
| SMILES | CC1(C)OC2C(=O)N3C(CO)CC(O)(O)C3C2O1 |
| InChI | InChI=1S/C11H17NO6/c1-10(2)17-6-7(18-10)9(14)12-5(4-13)3-11(15,16)8(6)12/h5-8,13,15-16H,3-4H2,1-2H3 |
| InChIKey | YTYWCHXDRCGDML-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|