C30H30Cl2N2O7 — CID 68641059
methyl 2-(butoxycarbonylamino)-3-[(2S)-2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-3-oxo-4H-1,4-benzoxazin-6-yl]propanoate (PubChem CID 68641059) has the molecular formula C30H30Cl2N2O7 and a molecular weight of 601.48 g/mol. Its IUPAC name is methyl 2-(butoxycarbonylamino)-3-[(2S)-2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-3-oxo-4H-1,4-benzoxazin-6-yl]propanoate.
| Compound Name | methyl 2-(butoxycarbonylamino)-3-[(2S)-2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-3-oxo-4H-1,4-benzoxazin-6-yl]propanoate |
|---|---|
| PubChem CID | 68641059 |
| Molecular Formula | C30H30Cl2N2O7 |
| Molecular Weight | 601.48 g/mol |
| Exact Mass | 600.14 |
| IUPAC Name | methyl 2-(butoxycarbonylamino)-3-[(2S)-2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-3-oxo-4H-1,4-benzoxazin-6-yl]propanoate |
| SMILES | CCCCOC(=O)NC(Cc1ccc2c(c1)NC(=O)[C@H](c1ccc(OCc3ccc(Cl)c(Cl)c3)cc1)O2)C(=O)OC |
| InChI | InChI=1S/C30H30Cl2N2O7/c1-3-4-13-39-30(37)34-25(29(36)38-2)16-18-6-12-26-24(15-18)33-28(35)27(41-26)20-7-9-21(10-8-20)40-17-19-5-11-22(31)23(32)14-19/h5-12,14-15,25,27H,3-4,13,16-17H2,1-2H3,(H,33,35)(H,34,37)/t25?,27-/m0/s1 |
| InChIKey | VOCKCEFOADZDQA-GPNIZQGCSA-N |
| XLogP | 6.26 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.48 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|