C10H17NO6 — CID 68641902
(1,2,6,7-tetrahydroxy-2,3,5,6,7,8-hexahydropyrrolizin-1-yl)methyl acetate (PubChem CID 68641902) has the molecular formula C10H17NO6 and a molecular weight of 247.25 g/mol. Its IUPAC name is (1,2,6,7-tetrahydroxy-2,3,5,6,7,8-hexahydropyrrolizin-1-yl)methyl acetate.
| Compound Name | (1,2,6,7-tetrahydroxy-2,3,5,6,7,8-hexahydropyrrolizin-1-yl)methyl acetate |
|---|---|
| PubChem CID | 68641902 |
| Molecular Formula | C10H17NO6 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | (1,2,6,7-tetrahydroxy-2,3,5,6,7,8-hexahydropyrrolizin-1-yl)methyl acetate |
| SMILES | CC(=O)OCC1(O)C(O)CN2CC(O)C(O)C21 |
| InChI | InChI=1S/C10H17NO6/c1-5(12)17-4-10(16)7(14)3-11-2-6(13)8(15)9(10)11/h6-9,13-16H,2-4H2,1H3 |
| InChIKey | LKOBLTKFBRYKDA-UHFFFAOYSA-N |
| XLogP | -2.94 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |