C54H58N2O6S — CID 68642261
(Z)-2-cyano-3-[5-[4-[4-(2,4-dibutoxyphenyl)-N-[4-(2,4-dibutoxyphenyl)phenyl]anilino]phenyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 68642261) has the molecular formula C54H58N2O6S and a molecular weight of 863.13 g/mol. Its IUPAC name is (Z)-2-cyano-3-[5-[4-[4-(2,4-dibutoxyphenyl)-N-[4-(2,4-dibutoxyphenyl)phenyl]anilino]phenyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[5-[4-[4-(2,4-dibutoxyphenyl)-N-[4-(2,4-dibutoxyphenyl)phenyl]anilino]phenyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68642261 |
| Molecular Formula | C54H58N2O6S |
| Molecular Weight | 863.13 g/mol |
| Exact Mass | 862.40 |
| IUPAC Name | (Z)-2-cyano-3-[5-[4-[4-(2,4-dibutoxyphenyl)-N-[4-(2,4-dibutoxyphenyl)phenyl]anilino]phenyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCCCOc1ccc(-c2ccc(N(c3ccc(-c4ccc(/C=C(/C#N)C(=O)O)s4)cc3)c3ccc(-c4ccc(OCCCC)cc4OCCCC)cc3)cc2)c(OCCCC)c1 |
| InChI | InChI=1S/C54H58N2O6S/c1-5-9-31-59-46-25-28-49(51(36-46)61-33-11-7-3)39-13-19-43(20-14-39)56(45-23-17-41(18-24-45)53-30-27-48(63-53)35-42(38-55)54(57)58)44-21-15-40(16-22-44)50-29-26-47(60-32-10-6-2)37-52(50)62-34-12-8-4/h13-30,35-37H,5-12,31-34H2,1-4H3,(H,57,58)/b42-35- |
| InChIKey | YTGYSYJZMRLMIN-LLRJKHIDSA-N |
| XLogP | 14.93 |
| TPSA | 101.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.13 |
| LogP ≤ 5 | 14.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|