C20H18BO2 — CID 68642581
CID 68642581 (PubChem CID 68642581) has the molecular formula C20H18BO2 and a molecular weight of 301.17 g/mol.
| Compound Name | CID 68642581 |
|---|---|
| PubChem CID | 68642581 |
| Molecular Formula | C20H18BO2 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc2c(c1)-c1cccc3c(O[B]O)ccc-2c13 |
| InChI | InChI=1S/C20H18BO2/c1-20(2,3)12-7-8-13-15-9-10-18(23-21-22)16-6-4-5-14(19(15)16)17(13)11-12/h4-11,22H,1-3H3 |
| InChIKey | SWTLEAHTGJPJMQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|