About (2Z)-2-[(2,3-dimethylphenyl)methylidene]cyclohexan-1-one
(2Z)-2-[(2,3-dimethylphenyl)methylidene]cyclohexan-1-one (PubChem CID 68642758) has the molecular formula C15H18O
and a molecular weight of 214.31 g/mol. Its IUPAC name is (2Z)-2-[(2,3-dimethylphenyl)methylidene]cyclohexan-1-one.
Molecular Properties
| Compound Name | (2Z)-2-[(2,3-dimethylphenyl)methylidene]cyclohexan-1-one |
| PubChem CID | 68642758 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (2Z)-2-[(2,3-dimethylphenyl)methylidene]cyclohexan-1-one |
| SMILES | Cc1cccc(/C=C2/CCCCC2=O)c1C |
| InChI | InChI=1S/C15H18O/c1-11-6-5-8-13(12(11)2)10-14-7-3-4-9-15(14)16/h5-6,8,10H,3-4,7,9H2,1-2H3/b14-10- |
| InChIKey | XJVDMZPHLVZICG-UVTDQMKNSA-N |
| XLogP | 3.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[(2,3-dimethylphenyl)methylidene]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[(2,3-dimethylphenyl)methylidene]cyclohexan-1-one?
The IUPAC name of (2Z)-2-[(2,3-dimethylphenyl)methylidene]cyclohexan-1-one (CID 68642758) is (2Z)-2-[(2,3-dimethylphenyl)methylidene]cyclohexan-1-one.
What is the SMILES notation for (2Z)-2-[(2,3-dimethylphenyl)methylidene]cyclohexan-1-one?
The canonical SMILES for (2Z)-2-[(2,3-dimethylphenyl)methylidene]cyclohexan-1-one is Cc1cccc(/C=C2/CCCCC2=O)c1C.
What is the InChIKey of (2Z)-2-[(2,3-dimethylphenyl)methylidene]cyclohexan-1-one?
The InChIKey is XJVDMZPHLVZICG-UVTDQMKNSA-N. The full InChI is InChI=1S/C15H18O/c1-11-6-5-8-13(12(11)2)10-14-7-3-4-9-15(14)16/h5-6,8,10H,3-4,7,9H2,1-2H3/b14-10-.
What are the key properties of (2Z)-2-[(2,3-dimethylphenyl)methylidene]cyclohexan-1-one?
(2Z)-2-[(2,3-dimethylphenyl)methylidene]cyclohexan-1-one has a molecular weight of 214.31 g/mol, XLogP of 3.83, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[(2,3-dimethylphenyl)methylidene]cyclohexan-1-one is sourced from PubChem (CID 68642758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).