About (E)-1-cyclohexa-1,3-dien-1-ylhex-3-en-3-ol
(E)-1-cyclohexa-1,3-dien-1-ylhex-3-en-3-ol (PubChem CID 68642835) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is (E)-1-cyclohexa-1,3-dien-1-ylhex-3-en-3-ol.
Molecular Properties
| Compound Name | (E)-1-cyclohexa-1,3-dien-1-ylhex-3-en-3-ol |
| PubChem CID | 68642835 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (E)-1-cyclohexa-1,3-dien-1-ylhex-3-en-3-ol |
| SMILES | CC/C=C(/O)CCC1=CC=CCC1 |
| InChI | InChI=1S/C12H18O/c1-2-6-12(13)10-9-11-7-4-3-5-8-11/h3-4,6-7,13H,2,5,8-10H2,1H3/b12-6+ |
| InChIKey | DAZGTBPHQNMPBD-WUXMJOGZSA-N |
| XLogP | 3.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-cyclohexa-1,3-dien-1-ylhex-3-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-cyclohexa-1,3-dien-1-ylhex-3-en-3-ol?
The IUPAC name of (E)-1-cyclohexa-1,3-dien-1-ylhex-3-en-3-ol (CID 68642835) is (E)-1-cyclohexa-1,3-dien-1-ylhex-3-en-3-ol.
What is the SMILES notation for (E)-1-cyclohexa-1,3-dien-1-ylhex-3-en-3-ol?
The canonical SMILES for (E)-1-cyclohexa-1,3-dien-1-ylhex-3-en-3-ol is CC/C=C(/O)CCC1=CC=CCC1.
What is the InChIKey of (E)-1-cyclohexa-1,3-dien-1-ylhex-3-en-3-ol?
The InChIKey is DAZGTBPHQNMPBD-WUXMJOGZSA-N. The full InChI is InChI=1S/C12H18O/c1-2-6-12(13)10-9-11-7-4-3-5-8-11/h3-4,6-7,13H,2,5,8-10H2,1H3/b12-6+.
What are the key properties of (E)-1-cyclohexa-1,3-dien-1-ylhex-3-en-3-ol?
(E)-1-cyclohexa-1,3-dien-1-ylhex-3-en-3-ol has a molecular weight of 178.27 g/mol, XLogP of 3.89, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-cyclohexa-1,3-dien-1-ylhex-3-en-3-ol is sourced from PubChem (CID 68642835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).