5,5-dimethyl-2-propan-2-yl-1,2,6-thiadiazinane 1,1-dioxide

C8H18N2O2S — CID 68643207

IUPAC5,5-dimethyl-2-propan-2-yl-1,2,6-thiadiazinane 1,1-dioxide
SMILESCC(C)N1CCC(C)(C)NS1(=O)=O
InChIInChI=1S/C8H18N2O2S/c1-7(2)10-6-5-8(3,4)9-13(10,11)12/h7,9H,5-6H2,1-4H3
InChIKeyFXSUSNIJIHPAQT-UHFFFAOYSA-N
MW206.31 g/mol
LogP0.71
Rot. Bonds1

About 5,5-dimethyl-2-propan-2-yl-1,2,6-thiadiazinane 1,1-dioxide

5,5-dimethyl-2-propan-2-yl-1,2,6-thiadiazinane 1,1-dioxide (PubChem CID 68643207) has the molecular formula C8H18N2O2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 5,5-dimethyl-2-propan-2-yl-1,2,6-thiadiazinane 1,1-dioxide.

Molecular Properties

Compound Name5,5-dimethyl-2-propan-2-yl-1,2,6-thiadiazinane 1,1-dioxide
PubChem CID68643207
Molecular FormulaC8H18N2O2S
Molecular Weight206.31 g/mol
Exact Mass206.11
IUPAC Name5,5-dimethyl-2-propan-2-yl-1,2,6-thiadiazinane 1,1-dioxide
SMILESCC(C)N1CCC(C)(C)NS1(=O)=O
InChIInChI=1S/C8H18N2O2S/c1-7(2)10-6-5-8(3,4)9-13(10,11)12/h7,9H,5-6H2,1-4H3
InChIKeyFXSUSNIJIHPAQT-UHFFFAOYSA-N
XLogP0.71
TPSA49.41 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.31
LogP ≤ 50.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5,5-dimethyl-2-propan-2-yl-1,2,6-thiadiazinane 1,1-dioxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,5-dimethyl-2-propan-2-yl-1,2,6-thiadiazinane 1,1-dioxide?
The IUPAC name of 5,5-dimethyl-2-propan-2-yl-1,2,6-thiadiazinane 1,1-dioxide (CID 68643207) is 5,5-dimethyl-2-propan-2-yl-1,2,6-thiadiazinane 1,1-dioxide.
What is the SMILES notation for 5,5-dimethyl-2-propan-2-yl-1,2,6-thiadiazinane 1,1-dioxide?
The canonical SMILES for 5,5-dimethyl-2-propan-2-yl-1,2,6-thiadiazinane 1,1-dioxide is CC(C)N1CCC(C)(C)NS1(=O)=O.
What is the InChIKey of 5,5-dimethyl-2-propan-2-yl-1,2,6-thiadiazinane 1,1-dioxide?
The InChIKey is FXSUSNIJIHPAQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2S/c1-7(2)10-6-5-8(3,4)9-13(10,11)12/h7,9H,5-6H2,1-4H3.
What are the key properties of 5,5-dimethyl-2-propan-2-yl-1,2,6-thiadiazinane 1,1-dioxide?
5,5-dimethyl-2-propan-2-yl-1,2,6-thiadiazinane 1,1-dioxide has a molecular weight of 206.31 g/mol, XLogP of 0.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2-propan-2-yl-1,2,6-thiadiazinane 1,1-dioxide is sourced from PubChem (CID 68643207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).