About 2,6-bis(hydroxymethyl)-6-methylcyclohexa-1,3-dien-1-ol
2,6-bis(hydroxymethyl)-6-methylcyclohexa-1,3-dien-1-ol (PubChem CID 68643427) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2,6-bis(hydroxymethyl)-6-methylcyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 2,6-bis(hydroxymethyl)-6-methylcyclohexa-1,3-dien-1-ol |
| PubChem CID | 68643427 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2,6-bis(hydroxymethyl)-6-methylcyclohexa-1,3-dien-1-ol |
| SMILES | CC1(CO)CC=CC(CO)=C1O |
| InChI | InChI=1S/C9H14O3/c1-9(6-11)4-2-3-7(5-10)8(9)12/h2-3,10-12H,4-6H2,1H3 |
| InChIKey | JCWOYWGLRDFVSX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-bis(hydroxymethyl)-6-methylcyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(hydroxymethyl)-6-methylcyclohexa-1,3-dien-1-ol?
The IUPAC name of 2,6-bis(hydroxymethyl)-6-methylcyclohexa-1,3-dien-1-ol (CID 68643427) is 2,6-bis(hydroxymethyl)-6-methylcyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 2,6-bis(hydroxymethyl)-6-methylcyclohexa-1,3-dien-1-ol?
The canonical SMILES for 2,6-bis(hydroxymethyl)-6-methylcyclohexa-1,3-dien-1-ol is CC1(CO)CC=CC(CO)=C1O.
What is the InChIKey of 2,6-bis(hydroxymethyl)-6-methylcyclohexa-1,3-dien-1-ol?
The InChIKey is JCWOYWGLRDFVSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-9(6-11)4-2-3-7(5-10)8(9)12/h2-3,10-12H,4-6H2,1H3.
What are the key properties of 2,6-bis(hydroxymethyl)-6-methylcyclohexa-1,3-dien-1-ol?
2,6-bis(hydroxymethyl)-6-methylcyclohexa-1,3-dien-1-ol has a molecular weight of 170.21 g/mol, XLogP of 0.75, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(hydroxymethyl)-6-methylcyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 68643427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).