C21H42O4Si — CID 68643471
methyl 7-[(1S,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-methylcyclopentyl]heptanoate (PubChem CID 68643471) has the molecular formula C21H42O4Si and a molecular weight of 386.65 g/mol. Its IUPAC name is methyl 7-[(1S,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-methylcyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1S,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-methylcyclopentyl]heptanoate |
|---|---|
| PubChem CID | 68643471 |
| Molecular Formula | C21H42O4Si |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | methyl 7-[(1S,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-methylcyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1[C@@H](C)CC(O)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O4Si/c1-16-14-19(22)18(15-25-26(6,7)21(2,3)4)17(16)12-10-8-9-11-13-20(23)24-5/h16-19,22H,8-15H2,1-7H3/t16-,17-,18+,19?/m0/s1 |
| InChIKey | SLSREVMERYLPOI-HTUJPFKRSA-N |
| XLogP | 5.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|