C19H20N4O2 — CID 686437
N,N-diethyl-4,6-diphenoxy-1,3,5-triazin-2-amine (PubChem CID 686437) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is N,N-diethyl-4,6-diphenoxy-1,3,5-triazin-2-amine.
| Compound Name | N,N-diethyl-4,6-diphenoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 686437 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N,N-diethyl-4,6-diphenoxy-1,3,5-triazin-2-amine |
| SMILES | CCN(CC)c1nc(Oc2ccccc2)nc(Oc2ccccc2)n1 |
| InChI | InChI=1S/C19H20N4O2/c1-3-23(4-2)17-20-18(24-15-11-7-5-8-12-15)22-19(21-17)25-16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3 |
| InChIKey | QMXXSXQPMJQWIF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |