C27H22F3N5O2S — CID 68643737
N-[2-[5-[1-methyl-2-[3-(trifluoromethyl)phenyl]benzimidazol-5-yl]-2-oxo-6H-1,3,4-thiadiazin-3-yl]ethyl]benzamide (PubChem CID 68643737) has the molecular formula C27H22F3N5O2S and a molecular weight of 537.57 g/mol. Its IUPAC name is N-[2-[5-[1-methyl-2-[3-(trifluoromethyl)phenyl]benzimidazol-5-yl]-2-oxo-6H-1,3,4-thiadiazin-3-yl]ethyl]benzamide.
| Compound Name | N-[2-[5-[1-methyl-2-[3-(trifluoromethyl)phenyl]benzimidazol-5-yl]-2-oxo-6H-1,3,4-thiadiazin-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 68643737 |
| Molecular Formula | C27H22F3N5O2S |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | N-[2-[5-[1-methyl-2-[3-(trifluoromethyl)phenyl]benzimidazol-5-yl]-2-oxo-6H-1,3,4-thiadiazin-3-yl]ethyl]benzamide |
| SMILES | Cn1c(-c2cccc(C(F)(F)F)c2)nc2cc(C3=NN(CCNC(=O)c4ccccc4)C(=O)SC3)ccc21 |
| InChI | InChI=1S/C27H22F3N5O2S/c1-34-23-11-10-18(15-21(23)32-24(34)19-8-5-9-20(14-19)27(28,29)30)22-16-38-26(37)35(33-22)13-12-31-25(36)17-6-3-2-4-7-17/h2-11,14-15H,12-13,16H2,1H3,(H,31,36) |
| InChIKey | STHWTFNFPOVUSP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|