C25H23N5O3S — CID 68643902
N-[2-[5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-2-oxo-6H-1,3,4-thiadiazin-3-yl]ethyl]-4-methylbenzamide (PubChem CID 68643902) has the molecular formula C25H23N5O3S and a molecular weight of 473.56 g/mol. Its IUPAC name is N-[2-[5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-2-oxo-6H-1,3,4-thiadiazin-3-yl]ethyl]-4-methylbenzamide.
| Compound Name | N-[2-[5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-2-oxo-6H-1,3,4-thiadiazin-3-yl]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 68643902 |
| Molecular Formula | C25H23N5O3S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | N-[2-[5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-2-oxo-6H-1,3,4-thiadiazin-3-yl]ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCN2N=C(c3ccc4c(c3)nc(-c3ccco3)n4C)CSC2=O)cc1 |
| InChI | InChI=1S/C25H23N5O3S/c1-16-5-7-17(8-6-16)24(31)26-11-12-30-25(32)34-15-20(28-30)18-9-10-21-19(14-18)27-23(29(21)2)22-4-3-13-33-22/h3-10,13-14H,11-12,15H2,1-2H3,(H,26,31) |
| InChIKey | TZBZTUSEXKHXRA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|