C8H9Cl3N2O3 — CID 68644114
(3,4-dimethyl-1,2-oxazol-5-yl)-(2,2,2-trichloroethyl)carbamic acid (PubChem CID 68644114) has the molecular formula C8H9Cl3N2O3 and a molecular weight of 287.53 g/mol. Its IUPAC name is (3,4-dimethyl-1,2-oxazol-5-yl)-(2,2,2-trichloroethyl)carbamic acid.
| Compound Name | (3,4-dimethyl-1,2-oxazol-5-yl)-(2,2,2-trichloroethyl)carbamic acid |
|---|---|
| PubChem CID | 68644114 |
| Molecular Formula | C8H9Cl3N2O3 |
| Molecular Weight | 287.53 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | (3,4-dimethyl-1,2-oxazol-5-yl)-(2,2,2-trichloroethyl)carbamic acid |
| SMILES | Cc1noc(N(CC(Cl)(Cl)Cl)C(=O)O)c1C |
| InChI | InChI=1S/C8H9Cl3N2O3/c1-4-5(2)12-16-6(4)13(7(14)15)3-8(9,10)11/h3H2,1-2H3,(H,14,15) |
| InChIKey | ZGQPOWFSFFSUMF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|