About [4-[2-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl acetate
[4-[2-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl acetate (PubChem CID 68644333) has the molecular formula C18H16F3NO5S
and a molecular weight of 415.39 g/mol. Its IUPAC name is [4-[2-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl acetate.
Molecular Properties
| Compound Name | [4-[2-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl acetate |
| PubChem CID | 68644333 |
| Molecular Formula | C18H16F3NO5S |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | [4-[2-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl acetate |
| SMILES | CC(=O)OCC1COc2ccccc2N1S(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H16F3NO5S/c1-12(23)26-10-13-11-27-16-8-4-3-7-15(16)22(13)28(24,25)17-9-5-2-6-14(17)18(19,20)21/h2-9,13H,10-11H2,1H3 |
| InChIKey | KDCRDKLTQQOXLV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[2-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl acetate?
The IUPAC name of [4-[2-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl acetate (CID 68644333) is [4-[2-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl acetate.
What is the SMILES notation for [4-[2-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl acetate?
The canonical SMILES for [4-[2-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl acetate is CC(=O)OCC1COc2ccccc2N1S(=O)(=O)c1ccccc1C(F)(F)F.
What is the InChIKey of [4-[2-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl acetate?
The InChIKey is KDCRDKLTQQOXLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F3NO5S/c1-12(23)26-10-13-11-27-16-8-4-3-7-15(16)22(13)28(24,25)17-9-5-2-6-14(17)18(19,20)21/h2-9,13H,10-11H2,1H3.
What are the key properties of [4-[2-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl acetate?
[4-[2-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl acetate has a molecular weight of 415.39 g/mol, XLogP of 3.22, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl acetate is sourced from PubChem (CID 68644333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).