C34H47BO4 — CID 68644575
[3,5-bis[2-(4-ethylhexoxy)phenyl]phenyl]boronic acid (PubChem CID 68644575) has the molecular formula C34H47BO4 and a molecular weight of 530.56 g/mol. Its IUPAC name is [3,5-bis[2-(4-ethylhexoxy)phenyl]phenyl]boronic acid.
| Compound Name | [3,5-bis[2-(4-ethylhexoxy)phenyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 68644575 |
| Molecular Formula | C34H47BO4 |
| Molecular Weight | 530.56 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | [3,5-bis[2-(4-ethylhexoxy)phenyl]phenyl]boronic acid |
| SMILES | CCC(CC)CCCOc1ccccc1-c1cc(B(O)O)cc(-c2ccccc2OCCCC(CC)CC)c1 |
| InChI | InChI=1S/C34H47BO4/c1-5-26(6-2)15-13-21-38-33-19-11-9-17-31(33)28-23-29(25-30(24-28)35(36)37)32-18-10-12-20-34(32)39-22-14-16-27(7-3)8-4/h9-12,17-20,23-27,36-37H,5-8,13-16,21-22H2,1-4H3 |
| InChIKey | TXTKQGKNAZRYCK-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.56 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|