C27H32F2N6O — CID 68644663
(2R,3R)-2-(2,4-difluorophenyl)-3-[5-[(3,4-dimethylcyclohexyl)amino]indazol-1-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 68644663) has the molecular formula C27H32F2N6O and a molecular weight of 494.59 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[5-[(3,4-dimethylcyclohexyl)amino]indazol-1-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[5-[(3,4-dimethylcyclohexyl)amino]indazol-1-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 68644663 |
| Molecular Formula | C27H32F2N6O |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[5-[(3,4-dimethylcyclohexyl)amino]indazol-1-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | CC1CCC(Nc2ccc3c(cnn3[C@H](C)[C@](O)(Cn3cncn3)c3ccc(F)cc3F)c2)CC1C |
| InChI | InChI=1S/C27H32F2N6O/c1-17-4-6-22(10-18(17)2)33-23-7-9-26-20(11-23)13-31-35(26)19(3)27(36,14-34-16-30-15-32-34)24-8-5-21(28)12-25(24)29/h5,7-9,11-13,15-19,22,33,36H,4,6,10,14H2,1-3H3/t17?,18?,19-,22?,27-/m1/s1 |
| InChIKey | ZOFWJYURRYEFRE-BZBUUANXSA-N |
| XLogP | 5.29 |
| TPSA | 80.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |