C22H30N8O2 — CID 68645142
[2-[[[5-[(2-aminocyclohexyl)amino]-3-propan-2-yltriazolo[4,5-d]pyrimidin-7-yl]amino]methyl]phenyl] acetate (PubChem CID 68645142) has the molecular formula C22H30N8O2 and a molecular weight of 438.54 g/mol. Its IUPAC name is [2-[[[5-[(2-aminocyclohexyl)amino]-3-propan-2-yltriazolo[4,5-d]pyrimidin-7-yl]amino]methyl]phenyl] acetate.
| Compound Name | [2-[[[5-[(2-aminocyclohexyl)amino]-3-propan-2-yltriazolo[4,5-d]pyrimidin-7-yl]amino]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 68645142 |
| Molecular Formula | C22H30N8O2 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | [2-[[[5-[(2-aminocyclohexyl)amino]-3-propan-2-yltriazolo[4,5-d]pyrimidin-7-yl]amino]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1CNc1nc(NC2CCCCC2N)nc2c1nnn2C(C)C |
| InChI | InChI=1S/C22H30N8O2/c1-13(2)30-21-19(28-29-30)20(24-12-15-8-4-7-11-18(15)32-14(3)31)26-22(27-21)25-17-10-6-5-9-16(17)23/h4,7-8,11,13,16-17H,5-6,9-10,12,23H2,1-3H3,(H2,24,25,26,27) |
| InChIKey | GEVYRVCCCLDSBE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 132.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|