C17H23N7O4 — CID 68645350
3-[[[3-ethyl-5-(2-hydroxypropylamino)triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-6-methoxybenzene-1,2-diol (PubChem CID 68645350) has the molecular formula C17H23N7O4 and a molecular weight of 389.42 g/mol. Its IUPAC name is 3-[[[3-ethyl-5-(2-hydroxypropylamino)triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-6-methoxybenzene-1,2-diol.
| Compound Name | 3-[[[3-ethyl-5-(2-hydroxypropylamino)triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-6-methoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 68645350 |
| Molecular Formula | C17H23N7O4 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 3-[[[3-ethyl-5-(2-hydroxypropylamino)triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-6-methoxybenzene-1,2-diol |
| SMILES | CCn1nnc2c(NCc3ccc(OC)c(O)c3O)nc(NCC(C)O)nc21 |
| InChI | InChI=1S/C17H23N7O4/c1-4-24-16-12(22-23-24)15(20-17(21-16)19-7-9(2)25)18-8-10-5-6-11(28-3)14(27)13(10)26/h5-6,9,25-27H,4,7-8H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | DVDJBJAJTIDNJH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 150.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|