C15H9N3O3S2 — CID 68645620
4-methylsulfanyl-8-oxo-11-thia-1,3,5-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,9,12,14,16-heptaene-9-carboxylic acid (PubChem CID 68645620) has the molecular formula C15H9N3O3S2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 4-methylsulfanyl-8-oxo-11-thia-1,3,5-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,9,12,14,16-heptaene-9-carboxylic acid.
| Compound Name | 4-methylsulfanyl-8-oxo-11-thia-1,3,5-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,9,12,14,16-heptaene-9-carboxylic acid |
|---|---|
| PubChem CID | 68645620 |
| Molecular Formula | C15H9N3O3S2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 4-methylsulfanyl-8-oxo-11-thia-1,3,5-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,9,12,14,16-heptaene-9-carboxylic acid |
| SMILES | CSc1ncc2c(=O)c(C(=O)O)c3sc4ccccc4n3c2n1 |
| InChI | InChI=1S/C15H9N3O3S2/c1-22-15-16-6-7-11(19)10(14(20)21)13-18(12(7)17-15)8-4-2-3-5-9(8)23-13/h2-6H,1H3,(H,20,21) |
| InChIKey | ZTUKFUQZZRQLQB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |