C16H22N8O3 — CID 68645728
3-[[[5-(2-aminopropylamino)-3-methyltriazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-6-methoxybenzene-1,2-diol (PubChem CID 68645728) has the molecular formula C16H22N8O3 and a molecular weight of 374.41 g/mol. Its IUPAC name is 3-[[[5-(2-aminopropylamino)-3-methyltriazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-6-methoxybenzene-1,2-diol.
| Compound Name | 3-[[[5-(2-aminopropylamino)-3-methyltriazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-6-methoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 68645728 |
| Molecular Formula | C16H22N8O3 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 3-[[[5-(2-aminopropylamino)-3-methyltriazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-6-methoxybenzene-1,2-diol |
| SMILES | COc1ccc(CNc2nc(NCC(C)N)nc3c2nnn3C)c(O)c1O |
| InChI | InChI=1S/C16H22N8O3/c1-8(17)6-19-16-20-14(11-15(21-16)24(2)23-22-11)18-7-9-4-5-10(27-3)13(26)12(9)25/h4-5,8,25-26H,6-7,17H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | CJECAZCZWOYDPO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 156.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|