About zinc;(2S)-3-hydroxypyrrolidine-2-carboxylate;(2S,3S)-3-hydroxypyrrolidine-2-carboxylate
zinc;(2S)-3-hydroxypyrrolidine-2-carboxylate;(2S,3S)-3-hydroxypyrrolidine-2-carboxylate (PubChem CID 68645772) has the molecular formula C10H16N2O6Zn
and a molecular weight of 325.64 g/mol. Its IUPAC name is zinc;(2S)-3-hydroxypyrrolidine-2-carboxylate;(2S,3S)-3-hydroxypyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | zinc;(2S)-3-hydroxypyrrolidine-2-carboxylate;(2S,3S)-3-hydroxypyrrolidine-2-carboxylate |
| PubChem CID | 68645772 |
| Molecular Formula | C10H16N2O6Zn |
| Molecular Weight | 325.64 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | zinc;(2S)-3-hydroxypyrrolidine-2-carboxylate;(2S,3S)-3-hydroxypyrrolidine-2-carboxylate |
| SMILES | O=C([O-])[C@H]1NCCC1O.O=C([O-])[C@H]1NCC[C@@H]1O.[Zn+2] |
| InChI | InChI=1S/2C5H9NO3.Zn/c2*7-3-1-2-6-4(3)5(8)9;/h2*3-4,6-7H,1-2H2,(H,8,9);/q;;+2/p-2/t3?,4-;3-,4-;/m00./s1 |
| InChIKey | BHXNRFBZYPUKKS-GWNOTGAUSA-L |
| XLogP | -5.08 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.64 |
| LogP ≤ 5 | -5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;(2S)-3-hydroxypyrrolidine-2-carboxylate;(2S,3S)-3-hydroxypyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;(2S)-3-hydroxypyrrolidine-2-carboxylate;(2S,3S)-3-hydroxypyrrolidine-2-carboxylate?
The IUPAC name of zinc;(2S)-3-hydroxypyrrolidine-2-carboxylate;(2S,3S)-3-hydroxypyrrolidine-2-carboxylate (CID 68645772) is zinc;(2S)-3-hydroxypyrrolidine-2-carboxylate;(2S,3S)-3-hydroxypyrrolidine-2-carboxylate.
What is the SMILES notation for zinc;(2S)-3-hydroxypyrrolidine-2-carboxylate;(2S,3S)-3-hydroxypyrrolidine-2-carboxylate?
The canonical SMILES for zinc;(2S)-3-hydroxypyrrolidine-2-carboxylate;(2S,3S)-3-hydroxypyrrolidine-2-carboxylate is O=C([O-])[C@H]1NCCC1O.O=C([O-])[C@H]1NCC[C@@H]1O.[Zn+2].
What is the InChIKey of zinc;(2S)-3-hydroxypyrrolidine-2-carboxylate;(2S,3S)-3-hydroxypyrrolidine-2-carboxylate?
The InChIKey is BHXNRFBZYPUKKS-GWNOTGAUSA-L. The full InChI is InChI=1S/2C5H9NO3.Zn/c2*7-3-1-2-6-4(3)5(8)9;/h2*3-4,6-7H,1-2H2,(H,8,9);/q;;+2/p-2/t3?,4-;3-,4-;/m00./s1.
What are the key properties of zinc;(2S)-3-hydroxypyrrolidine-2-carboxylate;(2S,3S)-3-hydroxypyrrolidine-2-carboxylate?
zinc;(2S)-3-hydroxypyrrolidine-2-carboxylate;(2S,3S)-3-hydroxypyrrolidine-2-carboxylate has a molecular weight of 325.64 g/mol, XLogP of -5.08, 2 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;(2S)-3-hydroxypyrrolidine-2-carboxylate;(2S,3S)-3-hydroxypyrrolidine-2-carboxylate is sourced from PubChem (CID 68645772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).