About 2-cyclohexyl-2-[2-(2,6-dimethoxy-3-pyridinyl)-5-fluorobenzimidazol-1-yl]acetic acid
2-cyclohexyl-2-[2-(2,6-dimethoxy-3-pyridinyl)-5-fluorobenzimidazol-1-yl]acetic acid (PubChem CID 68645802) has the molecular formula C22H24FN3O4
and a molecular weight of 413.45 g/mol. Its IUPAC name is 2-cyclohexyl-2-[2-(2,6-dimethoxy-3-pyridinyl)-5-fluorobenzimidazol-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-cyclohexyl-2-[2-(2,6-dimethoxy-3-pyridinyl)-5-fluorobenzimidazol-1-yl]acetic acid |
| PubChem CID | 68645802 |
| Molecular Formula | C22H24FN3O4 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 2-cyclohexyl-2-[2-(2,6-dimethoxy-3-pyridinyl)-5-fluorobenzimidazol-1-yl]acetic acid |
| SMILES | COc1ccc(-c2nc3cc(F)ccc3n2C(C(=O)O)C2CCCCC2)c(OC)n1 |
| InChI | InChI=1S/C22H24FN3O4/c1-29-18-11-9-15(21(25-18)30-2)20-24-16-12-14(23)8-10-17(16)26(20)19(22(27)28)13-6-4-3-5-7-13/h8-13,19H,3-7H2,1-2H3,(H,27,28) |
| InChIKey | XFZGNYVMLILEMI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-cyclohexyl-2-[2-(2,6-dimethoxy-3-pyridinyl)-5-fluorobenzimidazol-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-2-[2-(2,6-dimethoxy-3-pyridinyl)-5-fluorobenzimidazol-1-yl]acetic acid?
The IUPAC name of 2-cyclohexyl-2-[2-(2,6-dimethoxy-3-pyridinyl)-5-fluorobenzimidazol-1-yl]acetic acid (CID 68645802) is 2-cyclohexyl-2-[2-(2,6-dimethoxy-3-pyridinyl)-5-fluorobenzimidazol-1-yl]acetic acid.
What is the SMILES notation for 2-cyclohexyl-2-[2-(2,6-dimethoxy-3-pyridinyl)-5-fluorobenzimidazol-1-yl]acetic acid?
The canonical SMILES for 2-cyclohexyl-2-[2-(2,6-dimethoxy-3-pyridinyl)-5-fluorobenzimidazol-1-yl]acetic acid is COc1ccc(-c2nc3cc(F)ccc3n2C(C(=O)O)C2CCCCC2)c(OC)n1.
What is the InChIKey of 2-cyclohexyl-2-[2-(2,6-dimethoxy-3-pyridinyl)-5-fluorobenzimidazol-1-yl]acetic acid?
The InChIKey is XFZGNYVMLILEMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24FN3O4/c1-29-18-11-9-15(21(25-18)30-2)20-24-16-12-14(23)8-10-17(16)26(20)19(22(27)28)13-6-4-3-5-7-13/h8-13,19H,3-7H2,1-2H3,(H,27,28).
What are the key properties of 2-cyclohexyl-2-[2-(2,6-dimethoxy-3-pyridinyl)-5-fluorobenzimidazol-1-yl]acetic acid?
2-cyclohexyl-2-[2-(2,6-dimethoxy-3-pyridinyl)-5-fluorobenzimidazol-1-yl]acetic acid has a molecular weight of 413.45 g/mol, XLogP of 4.46, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-2-[2-(2,6-dimethoxy-3-pyridinyl)-5-fluorobenzimidazol-1-yl]acetic acid is sourced from PubChem (CID 68645802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).