C12H13N3 — CID 68645865
6-methyl-4,6,12-triazatetracyclo[7.5.0.03,7.010,14]tetradeca-1,3(7),4,8-tetraene (PubChem CID 68645865) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 6-methyl-4,6,12-triazatetracyclo[7.5.0.03,7.010,14]tetradeca-1,3(7),4,8-tetraene.
| Compound Name | 6-methyl-4,6,12-triazatetracyclo[7.5.0.03,7.010,14]tetradeca-1,3(7),4,8-tetraene |
|---|---|
| PubChem CID | 68645865 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 6-methyl-4,6,12-triazatetracyclo[7.5.0.03,7.010,14]tetradeca-1,3(7),4,8-tetraene |
| SMILES | Cn1cnc2cc3c(cc21)C1CNCC31 |
| InChI | InChI=1S/C12H13N3/c1-15-6-14-11-2-7-8(3-12(11)15)10-5-13-4-9(7)10/h2-3,6,9-10,13H,4-5H2,1H3 |
| InChIKey | RPVJVLPVGRPDGY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |