C20H28N8O3 — CID 68645873
2-[[[5-[(4-aminocyclohexyl)amino]-3-ethyltriazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-5-methoxybenzene-1,4-diol (PubChem CID 68645873) has the molecular formula C20H28N8O3 and a molecular weight of 428.50 g/mol. Its IUPAC name is 2-[[[5-[(4-aminocyclohexyl)amino]-3-ethyltriazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-5-methoxybenzene-1,4-diol.
| Compound Name | 2-[[[5-[(4-aminocyclohexyl)amino]-3-ethyltriazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-5-methoxybenzene-1,4-diol |
|---|---|
| PubChem CID | 68645873 |
| Molecular Formula | C20H28N8O3 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 2-[[[5-[(4-aminocyclohexyl)amino]-3-ethyltriazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-5-methoxybenzene-1,4-diol |
| SMILES | CCn1nnc2c(NCc3cc(O)c(OC)cc3O)nc(NC3CCC(N)CC3)nc21 |
| InChI | InChI=1S/C20H28N8O3/c1-3-28-19-17(26-27-28)18(22-10-11-8-15(30)16(31-2)9-14(11)29)24-20(25-19)23-13-6-4-12(21)5-7-13/h8-9,12-13,29-30H,3-7,10,21H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | VBDDBPQOJQFXNL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 156.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|