C19H27N7O4 — CID 68645950
3-[[[3-ethyl-5-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-6-methoxybenzene-1,2-diol (PubChem CID 68645950) has the molecular formula C19H27N7O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 3-[[[3-ethyl-5-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-6-methoxybenzene-1,2-diol.
| Compound Name | 3-[[[3-ethyl-5-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-6-methoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 68645950 |
| Molecular Formula | C19H27N7O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 3-[[[3-ethyl-5-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-6-methoxybenzene-1,2-diol |
| SMILES | CCn1nnc2c(NCc3ccc(OC)c(O)c3O)nc(N[C@@H](CO)C(C)C)nc21 |
| InChI | InChI=1S/C19H27N7O4/c1-5-26-18-14(24-25-26)17(22-19(23-18)21-12(9-27)10(2)3)20-8-11-6-7-13(30-4)16(29)15(11)28/h6-7,10,12,27-29H,5,8-9H2,1-4H3,(H2,20,21,22,23)/t12-/m0/s1 |
| InChIKey | YKTZHDLKSHFCIV-LBPRGKRZSA-N |
| XLogP | 1.70 |
| TPSA | 150.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|