C20H29N9 — CID 68645993
5-N-(2-aminocyclohexyl)-7-N-[(2-aminophenyl)methyl]-3-propan-2-yltriazolo[4,5-d]pyrimidine-5,7-diamine (PubChem CID 68645993) has the molecular formula C20H29N9 and a molecular weight of 395.52 g/mol. Its IUPAC name is 5-N-(2-aminocyclohexyl)-7-N-[(2-aminophenyl)methyl]-3-propan-2-yltriazolo[4,5-d]pyrimidine-5,7-diamine.
| Compound Name | 5-N-(2-aminocyclohexyl)-7-N-[(2-aminophenyl)methyl]-3-propan-2-yltriazolo[4,5-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 68645993 |
| Molecular Formula | C20H29N9 |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | 5-N-(2-aminocyclohexyl)-7-N-[(2-aminophenyl)methyl]-3-propan-2-yltriazolo[4,5-d]pyrimidine-5,7-diamine |
| SMILES | CC(C)n1nnc2c(NCc3ccccc3N)nc(NC3CCCCC3N)nc21 |
| InChI | InChI=1S/C20H29N9/c1-12(2)29-19-17(27-28-29)18(23-11-13-7-3-4-8-14(13)21)25-20(26-19)24-16-10-6-5-9-15(16)22/h3-4,7-8,12,15-16H,5-6,9-11,21-22H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | BWDZSWDIVDMBFW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 132.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|