About 3-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)sulfanyl]propan-1-amine
3-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)sulfanyl]propan-1-amine (PubChem CID 68646376) has the molecular formula C10H14BNO2S
and a molecular weight of 223.11 g/mol. Its IUPAC name is 3-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)sulfanyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)sulfanyl]propan-1-amine |
| PubChem CID | 68646376 |
| Molecular Formula | C10H14BNO2S |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 3-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)sulfanyl]propan-1-amine |
| SMILES | NCCCSc1cccc2c1B(O)OC2 |
| InChI | InChI=1S/C10H14BNO2S/c12-5-2-6-15-9-4-1-3-8-7-14-11(13)10(8)9/h1,3-4,13H,2,5-7,12H2 |
| InChIKey | KVYUIRMDHCNPDX-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)sulfanyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)sulfanyl]propan-1-amine?
The IUPAC name of 3-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)sulfanyl]propan-1-amine (CID 68646376) is 3-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)sulfanyl]propan-1-amine.
What is the SMILES notation for 3-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)sulfanyl]propan-1-amine?
The canonical SMILES for 3-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)sulfanyl]propan-1-amine is NCCCSc1cccc2c1B(O)OC2.
What is the InChIKey of 3-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)sulfanyl]propan-1-amine?
The InChIKey is KVYUIRMDHCNPDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BNO2S/c12-5-2-6-15-9-4-1-3-8-7-14-11(13)10(8)9/h1,3-4,13H,2,5-7,12H2.
What are the key properties of 3-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)sulfanyl]propan-1-amine?
3-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)sulfanyl]propan-1-amine has a molecular weight of 223.11 g/mol, XLogP of 0.35, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)sulfanyl]propan-1-amine is sourced from PubChem (CID 68646376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).