About 2,3-bis(ethenyl)porphyrin
2,3-bis(ethenyl)porphyrin (PubChem CID 68646483) has the molecular formula C24H16N4
and a molecular weight of 360.42 g/mol. Its IUPAC name is 2,3-bis(ethenyl)porphyrin.
Molecular Properties
| Compound Name | 2,3-bis(ethenyl)porphyrin |
| PubChem CID | 68646483 |
| Molecular Formula | C24H16N4 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2,3-bis(ethenyl)porphyrin |
| SMILES | C=CC1=C(C=C)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3 |
| InChI | InChI=1S/C24H16N4/c1-3-21-22(4-2)24-14-20-10-8-18(27-20)12-16-6-5-15(25-16)11-17-7-9-19(26-17)13-23(21)28-24/h3-14H,1-2H2/b15-11-,16-12-,17-11-,18-12-,19-13-,20-14-,23-13-,24-14- |
| InChIKey | QGOAEQBGMNLMGE-QSONDJRLSA-N |
| XLogP | 4.69 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-bis(ethenyl)porphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(ethenyl)porphyrin?
The IUPAC name of 2,3-bis(ethenyl)porphyrin (CID 68646483) is 2,3-bis(ethenyl)porphyrin.
What is the SMILES notation for 2,3-bis(ethenyl)porphyrin?
The canonical SMILES for 2,3-bis(ethenyl)porphyrin is C=CC1=C(C=C)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.
What is the InChIKey of 2,3-bis(ethenyl)porphyrin?
The InChIKey is QGOAEQBGMNLMGE-QSONDJRLSA-N. The full InChI is InChI=1S/C24H16N4/c1-3-21-22(4-2)24-14-20-10-8-18(27-20)12-16-6-5-15(25-16)11-17-7-9-19(26-17)13-23(21)28-24/h3-14H,1-2H2/b15-11-,16-12-,17-11-,18-12-,19-13-,20-14-,23-13-,24-14-.
What are the key properties of 2,3-bis(ethenyl)porphyrin?
2,3-bis(ethenyl)porphyrin has a molecular weight of 360.42 g/mol, XLogP of 4.69, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(ethenyl)porphyrin is sourced from PubChem (CID 68646483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).