About 1-hydroxy-3H-2,1-benzoxaborole-3-carboxamide;hydrochloride
1-hydroxy-3H-2,1-benzoxaborole-3-carboxamide;hydrochloride (PubChem CID 68646508) has the molecular formula C8H9BClNO3
and a molecular weight of 213.43 g/mol. Its IUPAC name is 1-hydroxy-3H-2,1-benzoxaborole-3-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 1-hydroxy-3H-2,1-benzoxaborole-3-carboxamide;hydrochloride |
| PubChem CID | 68646508 |
| Molecular Formula | C8H9BClNO3 |
| Molecular Weight | 213.43 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 1-hydroxy-3H-2,1-benzoxaborole-3-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)C1OB(O)c2ccccc21 |
| InChI | InChI=1S/C8H8BNO3.ClH/c10-8(11)7-5-3-1-2-4-6(5)9(12)13-7;/h1-4,7,12H,(H2,10,11);1H |
| InChIKey | XCWWGWXJXFDIJG-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.43 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3H-2,1-benzoxaborole-3-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3H-2,1-benzoxaborole-3-carboxamide;hydrochloride?
The IUPAC name of 1-hydroxy-3H-2,1-benzoxaborole-3-carboxamide;hydrochloride (CID 68646508) is 1-hydroxy-3H-2,1-benzoxaborole-3-carboxamide;hydrochloride.
What is the SMILES notation for 1-hydroxy-3H-2,1-benzoxaborole-3-carboxamide;hydrochloride?
The canonical SMILES for 1-hydroxy-3H-2,1-benzoxaborole-3-carboxamide;hydrochloride is Cl.NC(=O)C1OB(O)c2ccccc21.
What is the InChIKey of 1-hydroxy-3H-2,1-benzoxaborole-3-carboxamide;hydrochloride?
The InChIKey is XCWWGWXJXFDIJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BNO3.ClH/c10-8(11)7-5-3-1-2-4-6(5)9(12)13-7;/h1-4,7,12H,(H2,10,11);1H.
What are the key properties of 1-hydroxy-3H-2,1-benzoxaborole-3-carboxamide;hydrochloride?
1-hydroxy-3H-2,1-benzoxaborole-3-carboxamide;hydrochloride has a molecular weight of 213.43 g/mol, XLogP of -0.65, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3H-2,1-benzoxaborole-3-carboxamide;hydrochloride is sourced from PubChem (CID 68646508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).