C20H19ClFN5O3 — CID 68647074
4-[2-(3-chloro-4-fluoroanilino)-4-(3-methoxypropylamino)pyrimidin-5-yl]pyridine-3-carboxylic acid (PubChem CID 68647074) has the molecular formula C20H19ClFN5O3 and a molecular weight of 431.86 g/mol. Its IUPAC name is 4-[2-(3-chloro-4-fluoroanilino)-4-(3-methoxypropylamino)pyrimidin-5-yl]pyridine-3-carboxylic acid.
| Compound Name | 4-[2-(3-chloro-4-fluoroanilino)-4-(3-methoxypropylamino)pyrimidin-5-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 68647074 |
| Molecular Formula | C20H19ClFN5O3 |
| Molecular Weight | 431.86 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 4-[2-(3-chloro-4-fluoroanilino)-4-(3-methoxypropylamino)pyrimidin-5-yl]pyridine-3-carboxylic acid |
| SMILES | COCCCNc1nc(Nc2ccc(F)c(Cl)c2)ncc1-c1ccncc1C(=O)O |
| InChI | InChI=1S/C20H19ClFN5O3/c1-30-8-2-6-24-18-14(13-5-7-23-10-15(13)19(28)29)11-25-20(27-18)26-12-3-4-17(22)16(21)9-12/h3-5,7,9-11H,2,6,8H2,1H3,(H,28,29)(H2,24,25,26,27) |
| InChIKey | MMJVTFGXGWDDEB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.86 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|