C26H34ClN5O4S — CID 68647212
[3-[[1-[2-[(4-chlorophenyl)carbamoylamino]-3,3-dimethylbutanoyl]piperidin-4-yl]methyl]-4-prop-2-enyl-1,3-thiazol-2-ylidene]carbamic acid (PubChem CID 68647212) has the molecular formula C26H34ClN5O4S and a molecular weight of 548.11 g/mol. Its IUPAC name is [3-[[1-[2-[(4-chlorophenyl)carbamoylamino]-3,3-dimethylbutanoyl]piperidin-4-yl]methyl]-4-prop-2-enyl-1,3-thiazol-2-ylidene]carbamic acid.
| Compound Name | [3-[[1-[2-[(4-chlorophenyl)carbamoylamino]-3,3-dimethylbutanoyl]piperidin-4-yl]methyl]-4-prop-2-enyl-1,3-thiazol-2-ylidene]carbamic acid |
|---|---|
| PubChem CID | 68647212 |
| Molecular Formula | C26H34ClN5O4S |
| Molecular Weight | 548.11 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | [3-[[1-[2-[(4-chlorophenyl)carbamoylamino]-3,3-dimethylbutanoyl]piperidin-4-yl]methyl]-4-prop-2-enyl-1,3-thiazol-2-ylidene]carbamic acid |
| SMILES | C=CCc1csc(=NC(=O)O)n1CC1CCN(C(=O)C(NC(=O)Nc2ccc(Cl)cc2)C(C)(C)C)CC1 |
| InChI | InChI=1S/C26H34ClN5O4S/c1-5-6-20-16-37-24(30-25(35)36)32(20)15-17-11-13-31(14-12-17)22(33)21(26(2,3)4)29-23(34)28-19-9-7-18(27)8-10-19/h5,7-10,16-17,21H,1,6,11-15H2,2-4H3,(H,35,36)(H2,28,29,34) |
| InChIKey | IJATWNUGTHNKCT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.11 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|