C17H15BrN4O2S — CID 6864732
4-[(E)-(2-bromophenyl)methylideneamino]-3-(3,4-dimethoxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 6864732) has the molecular formula C17H15BrN4O2S and a molecular weight of 419.30 g/mol. Its IUPAC name is 4-[(E)-(2-bromophenyl)methylideneamino]-3-(3,4-dimethoxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(2-bromophenyl)methylideneamino]-3-(3,4-dimethoxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 6864732 |
| Molecular Formula | C17H15BrN4O2S |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 4-[(E)-(2-bromophenyl)methylideneamino]-3-(3,4-dimethoxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(-c2n[nH]c(=S)n2/N=C/c2ccccc2Br)cc1OC |
| InChI | InChI=1S/C17H15BrN4O2S/c1-23-14-8-7-11(9-15(14)24-2)16-20-21-17(25)22(16)19-10-12-5-3-4-6-13(12)18/h3-10H,1-2H3,(H,21,25)/b19-10+ |
| InChIKey | VFEKKOBTKZJXHG-VXLYETTFSA-N |
| XLogP | 4.27 |
| TPSA | 64.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|