About azane;2-ethyl-3-fluoroaniline
azane;2-ethyl-3-fluoroaniline (PubChem CID 68647628) has the molecular formula C8H13FN2
and a molecular weight of 156.20 g/mol. Its IUPAC name is azane;2-ethyl-3-fluoroaniline.
Molecular Properties
| Compound Name | azane;2-ethyl-3-fluoroaniline |
| PubChem CID | 68647628 |
| Molecular Formula | C8H13FN2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | azane;2-ethyl-3-fluoroaniline |
| SMILES | CCc1c(N)cccc1F.N |
| InChI | InChI=1S/C8H10FN.H3N/c1-2-6-7(9)4-3-5-8(6)10;/h3-5H,2,10H2,1H3;1H3 |
| InChIKey | NTXMHIUWMAYYPN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze azane;2-ethyl-3-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-ethyl-3-fluoroaniline?
The IUPAC name of azane;2-ethyl-3-fluoroaniline (CID 68647628) is azane;2-ethyl-3-fluoroaniline.
What is the SMILES notation for azane;2-ethyl-3-fluoroaniline?
The canonical SMILES for azane;2-ethyl-3-fluoroaniline is CCc1c(N)cccc1F.N.
What is the InChIKey of azane;2-ethyl-3-fluoroaniline?
The InChIKey is NTXMHIUWMAYYPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FN.H3N/c1-2-6-7(9)4-3-5-8(6)10;/h3-5H,2,10H2,1H3;1H3.
What are the key properties of azane;2-ethyl-3-fluoroaniline?
azane;2-ethyl-3-fluoroaniline has a molecular weight of 156.20 g/mol, XLogP of 2.13, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-ethyl-3-fluoroaniline is sourced from PubChem (CID 68647628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).